update ssl impls

actix-http/Cargo.toml

@@ -27,7 +27,7 @@ path = "src/lib.rs"
 default = []
 
 # openssl
-openssl = ["open-ssl", "actix-connect/openssl"]
+openssl = ["open-ssl", "actix-connect/openssl", "tokio-openssl"]
 
 # rustls support
 rustls = ["rust-tls", "webpki-roots", "actix-connect/rustls"]
@@ -100,6 +100,8 @@ flate2 = { version="1.0.7", optional = true, default-features = false }
 # optional deps
 failure = { version = "0.1.5", optional = true }
 open-ssl = { version="0.10", package="openssl", optional = true }
+tokio-openssl = { version = "0.4.0-alpha.6", optional = true }
+
 rust-tls = { version = "0.16.0", package="rustls", optional = true }
 webpki-roots = { version = "0.18", optional = true }
 

actix-http/src/client/connector.rs

@@ -20,22 +20,22 @@ use super::error::ConnectError;
 use super::pool::{ConnectionPool, Protocol};
 use super::Connect;
 
-#[cfg(feature = "ssl")]
+#[cfg(feature = "openssl")]
-use openssl::ssl::SslConnector as OpensslConnector;
+use open_ssl::ssl::SslConnector as OpensslConnector;
 
-#[cfg(feature = "rust-tls")]
+#[cfg(feature = "rustls")]
-use rustls::ClientConfig;
+use rust_tls::ClientConfig;
-#[cfg(feature = "rust-tls")]
+#[cfg(feature = "rustls")]
 use std::sync::Arc;
 
-#[cfg(any(feature = "ssl", feature = "rust-tls"))]
+#[cfg(any(feature = "openssl", feature = "rustls"))]
 enum SslConnector {
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     Openssl(OpensslConnector),
-    #[cfg(feature = "rust-tls")]
+    #[cfg(feature = "rustls")]
     Rustls(Arc<ClientConfig>),
 }
-#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+#[cfg(not(any(feature = "openssl", feature = "rustls")))]
 type SslConnector = ();
 
 /// Manages http client network connectivity
@@ -76,9 +76,9 @@ impl Connector<(), ()> {
         TcpStream,
     > {
         let ssl = {
-            #[cfg(feature = "ssl")]
+            #[cfg(feature = "openssl")]
             {
-                use openssl::ssl::SslMethod;
+                use open_ssl::ssl::SslMethod;
 
                 let mut ssl = OpensslConnector::builder(SslMethod::tls()).unwrap();
                 let _ = ssl
@@ -86,7 +86,7 @@ impl Connector<(), ()> {
                     .map_err(|e| error!("Can not set alpn protocol: {:?}", e));
                 SslConnector::Openssl(ssl.build())
             }
-            #[cfg(all(not(feature = "ssl"), feature = "rust-tls"))]
+            #[cfg(all(not(feature = "openssl"), feature = "rustls"))]
             {
                 let protos = vec![b"h2".to_vec(), b"http/1.1".to_vec()];
                 let mut config = ClientConfig::new();
@@ -96,7 +96,7 @@ impl Connector<(), ()> {
                     .add_server_trust_anchors(&webpki_roots::TLS_SERVER_ROOTS);
                 SslConnector::Rustls(Arc::new(config))
             }
-            #[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+            #[cfg(not(any(feature = "openssl", feature = "rustls")))]
             {}
         };
 
@@ -145,7 +145,8 @@ where
             Request = TcpConnect<Uri>,
             Response = TcpConnection<Uri, U>,
             Error = actix_connect::ConnectError,
-        > + 'static,
+        > + Clone
+        + 'static,
 {
     /// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
     /// Set to 1 second by default.
@@ -154,14 +155,14 @@ where
         self
     }
 
-    #[cfg(feature = "ssl")]
+    #[cfg(feature = "openssl")]
     /// Use custom `SslConnector` instance.
     pub fn ssl(mut self, connector: OpensslConnector) -> Self {
         self.ssl = SslConnector::Openssl(connector);
         self
     }
 
-    #[cfg(feature = "rust-tls")]
+    #[cfg(feature = "rustls")]
     pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
         self.ssl = SslConnector::Rustls(connector);
         self
@@ -217,7 +218,7 @@ where
         self,
     ) -> impl Service<Request = Connect, Response = impl Connection, Error = ConnectError>
            + Clone {
-        #[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+        #[cfg(not(any(feature = "openssl", feature = "rustls")))]
         {
             let connector = TimeoutService::new(
                 self.timeout,
@@ -242,46 +243,49 @@ where
                 ),
             }
         }
-        #[cfg(any(feature = "ssl", feature = "rust-tls"))]
+        #[cfg(any(feature = "openssl", feature = "rustls"))]
         {
             const H2: &[u8] = b"h2";
-            #[cfg(feature = "ssl")]
+            #[cfg(feature = "openssl")]
             use actix_connect::ssl::OpensslConnector;
-            #[cfg(feature = "rust-tls")]
+            #[cfg(feature = "rustls")]
             use actix_connect::ssl::RustlsConnector;
-            use actix_service::boxed::service;
+            use actix_service::{boxed::service, pipeline};
-            #[cfg(feature = "rust-tls")]
+            #[cfg(feature = "rustls")]
-            use rustls::Session;
+            use rust_tls::Session;
 
             let ssl_service = TimeoutService::new(
                 self.timeout,
-                apply_fn(self.connector.clone(), |msg: Connect, srv| {
+                pipeline(
-                    srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
+                    apply_fn(
-                })
+                        UnpinWrapper(self.connector.clone()),
-                .map_err(ConnectError::from)
+                        |msg: Connect, srv| {
+                            srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
+                        },
+                    )
+                    .map_err(ConnectError::from),
+                )
                 .and_then(match self.ssl {
-                    #[cfg(feature = "ssl")]
+                    #[cfg(feature = "openssl")]
-                    SslConnector::Openssl(ssl) => service(
+                    SslConnector::Openssl(ssl) => OpensslConnector::service(ssl)
-                        OpensslConnector::service(ssl)
+                        .map(|stream| {
-                            .map_err(ConnectError::from)
+                            let sock = stream.into_parts().0;
-                            .map(|stream| {
+                            let h2 = sock
-                                let sock = stream.into_parts().0;
+                                .ssl()
-                                let h2 = sock
+                                .selected_alpn_protocol()
-                                    .get_ref()
+                                .map(|protos| protos.windows(2).any(|w| w == H2))
-                                    .ssl()
+                                .unwrap_or(false);
-                                    .selected_alpn_protocol()
+                            if h2 {
-                                    .map(|protos| protos.windows(2).any(|w| w == H2))
+                                (Box::new(sock) as Box<dyn Io + Unpin>, Protocol::Http2)
-                                    .unwrap_or(false);
+                            } else {
-                                if h2 {
+                                (Box::new(sock) as Box<dyn Io + Unpin>, Protocol::Http1)
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
+                            }
-                                } else {
+                        })
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
+                        .map_err(ConnectError::from),
-                                }
+
-                            }),
+                    #[cfg(feature = "rustls")]
-                    ),
-                    #[cfg(feature = "rust-tls")]
                     SslConnector::Rustls(ssl) => service(
-                        RustlsConnector::service(ssl)
+                        UnpinWrapper(RustlsConnector::service(ssl))
                             .map_err(ConnectError::from)
                             .map(|stream| {
                                 let sock = stream.into_parts().0;
@@ -292,9 +296,15 @@ where
                                     .map(|protos| protos.windows(2).any(|w| w == H2))
                                     .unwrap_or(false);
                                 if h2 {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http2)
+                                    (
+                                        Box::new(sock) as Box<dyn Io + Unpin>,
+                                        Protocol::Http2,
+                                    )
                                 } else {
-                                    (Box::new(sock) as Box<dyn Io>, Protocol::Http1)
+                                    (
+                                        Box::new(sock) as Box<dyn Io + Unpin>,
+                                        Protocol::Http1,
+                                    )
                                 }
                             }),
                     ),
@@ -307,7 +317,7 @@ where
 
             let tcp_service = TimeoutService::new(
                 self.timeout,
-                apply_fn(self.connector.clone(), |msg: Connect, srv| {
+                apply_fn(UnpinWrapper(self.connector), |msg: Connect, srv| {
                     srv.call(TcpConnect::new(msg.uri).set_addr(msg.addr))
                 })
                 .map_err(ConnectError::from)
@@ -339,11 +349,11 @@ where
 }
 
 #[derive(Clone)]
-struct UnpinWrapper<T>(T);
+struct UnpinWrapper<T: Clone>(T);
 
-impl<T: Service> Unpin for UnpinWrapper<T> {}
+impl<T: Clone> Unpin for UnpinWrapper<T> {}
 
-impl<T: Service> Service for UnpinWrapper<T> {
+impl<T: Service + Clone> Service for UnpinWrapper<T> {
     type Request = T::Request;
     type Response = T::Response;
     type Error = T::Error;
@@ -374,7 +384,7 @@ impl<T: Service> Future for UnpinWrapperFut<T> {
     }
 }
 
-#[cfg(not(any(feature = "ssl", feature = "rust-tls")))]
+#[cfg(not(any(feature = "openssl", feature = "rustls")))]
 mod connect_impl {
     use std::task::{Context, Poll};
 
@@ -439,7 +449,7 @@ mod connect_impl {
     }
 }
 
-#[cfg(any(feature = "ssl", feature = "rust-tls"))]
+#[cfg(any(feature = "openssl", feature = "rustls"))]
 mod connect_impl {
     use std::marker::PhantomData;
 
@@ -510,11 +520,11 @@ mod connect_impl {
 
         fn call(&mut self, req: Connect) -> Self::Future {
             match req.uri.scheme_str() {
-                Some("https") | Some("wss") => Either::B(InnerConnectorResponseB {
+                Some("https") | Some("wss") => Either::Right(InnerConnectorResponseB {
                     fut: self.ssl_pool.call(req),
                     _t: PhantomData,
                 }),
-                _ => Either::A(InnerConnectorResponseA {
+                _ => Either::Left(InnerConnectorResponseA {
                     fut: self.tcp_pool.call(req),
                     _t: PhantomData,
                 }),

actix-http/src/cookie/secure/key.rs

@@ -1,13 +1,12 @@
-use ring::digest::{Algorithm, SHA256};
+use ring::hkdf::{Algorithm, KeyType, Prk, HKDF_SHA256};
-use ring::hkdf::expand;
+use ring::hmac;
-use ring::hmac::SigningKey;
 use ring::rand::{SecureRandom, SystemRandom};
 
 use super::private::KEY_LEN as PRIVATE_KEY_LEN;
 use super::signed::KEY_LEN as SIGNED_KEY_LEN;
 
-static HKDF_DIGEST: &Algorithm = &SHA256;
+static HKDF_DIGEST: Algorithm = HKDF_SHA256;
-const KEYS_INFO: &str = "COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM";
+const KEYS_INFO: &[&[u8]] = &[b"COOKIE;SIGNED:HMAC-SHA256;PRIVATE:AEAD-AES-256-GCM"];
 
 /// A cryptographic master key for use with `Signed` and/or `Private` jars.
 ///
@@ -25,6 +24,13 @@ pub struct Key {
     encryption_key: [u8; PRIVATE_KEY_LEN],
 }
 
+impl KeyType for &Key {
+    #[inline]
+    fn len(&self) -> usize {
+        SIGNED_KEY_LEN + PRIVATE_KEY_LEN
+    }
+}
+
 impl Key {
     /// Derives new signing/encryption keys from a master key.
     ///
@@ -56,21 +62,26 @@ impl Key {
             );
         }
 
-        // Expand the user's key into two.
+        // An empty `Key` structure; will be filled in with HKDF derived keys.
-        let prk = SigningKey::new(HKDF_DIGEST, key);
+        let mut output_key = Key {
+            signing_key: [0; SIGNED_KEY_LEN],
+            encryption_key: [0; PRIVATE_KEY_LEN],
+        };
+
+        // Expand the master key into two HKDF generated keys.
         let mut both_keys = [0; SIGNED_KEY_LEN + PRIVATE_KEY_LEN];
-        expand(&prk, KEYS_INFO.as_bytes(), &mut both_keys);
+        let prk = Prk::new_less_safe(HKDF_DIGEST, key);
+        let okm = prk.expand(KEYS_INFO, &output_key).expect("okm expand");
+        okm.fill(&mut both_keys).expect("fill keys");
 
-        // Copy the keys into their respective arrays.
+        // Copy the key parts into their respective fields.
-        let mut signing_key = [0; SIGNED_KEY_LEN];
+        output_key
-        let mut encryption_key = [0; PRIVATE_KEY_LEN];
+            .signing_key
-        signing_key.copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
+            .copy_from_slice(&both_keys[..SIGNED_KEY_LEN]);
-        encryption_key.copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
+        output_key
-
+            .encryption_key
-        Key {
+            .copy_from_slice(&both_keys[SIGNED_KEY_LEN..]);
-            signing_key,
+        output_key
-            encryption_key,
-        }
     }
 
     /// Generates signing/encryption keys from a secure, random source. Keys are

actix-http/src/cookie/secure/private.rs

@@ -1,8 +1,8 @@
 use std::str;
 
 use log::warn;
-use ring::aead::{open_in_place, seal_in_place, Aad, Algorithm, Nonce, AES_256_GCM};
+use ring::aead::{Aad, Algorithm, Nonce, AES_256_GCM};
-use ring::aead::{OpeningKey, SealingKey};
+use ring::aead::{LessSafeKey, UnboundKey};
 use ring::rand::{SecureRandom, SystemRandom};
 
 use super::Key;
@@ -10,7 +10,7 @@ use crate::cookie::{Cookie, CookieJar};
 
 // Keep these in sync, and keep the key len synced with the `private` docs as
 // well as the `KEYS_INFO` const in secure::Key.
-static ALGO: &Algorithm = &AES_256_GCM;
+static ALGO: &'static Algorithm = &AES_256_GCM;
 const NONCE_LEN: usize = 12;
 pub const KEY_LEN: usize = 32;
 
@@ -53,11 +53,14 @@ impl<'a> PrivateJar<'a> {
         }
 
         let ad = Aad::from(name.as_bytes());
-        let key = OpeningKey::new(ALGO, &self.key).expect("opening key");
+        let key = LessSafeKey::new(
-        let (nonce, sealed) = data.split_at_mut(NONCE_LEN);
+            UnboundKey::new(&ALGO, &self.key).expect("matching key length"),
+        );
+        let (nonce, mut sealed) = data.split_at_mut(NONCE_LEN);
         let nonce =
             Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
-        let unsealed = open_in_place(&key, nonce, ad, 0, sealed)
+        let unsealed = key
+            .open_in_place(nonce, ad, &mut sealed)
             .map_err(|_| "invalid key/nonce/value: bad seal")?;
 
         if let Ok(unsealed_utf8) = str::from_utf8(unsealed) {
@@ -196,30 +199,33 @@ Please change it as soon as possible."
 
 fn encrypt_name_value(name: &[u8], value: &[u8], key: &[u8]) -> Vec<u8> {
     // Create the `SealingKey` structure.
-    let key = SealingKey::new(ALGO, key).expect("sealing key creation");
+    let unbound = UnboundKey::new(&ALGO, key).expect("matching key length");
+    let key = LessSafeKey::new(unbound);
 
     // Create a vec to hold the [nonce | cookie value | overhead].
-    let overhead = ALGO.tag_len();
+    let mut data = vec![0; NONCE_LEN + value.len() + ALGO.tag_len()];
-    let mut data = vec![0; NONCE_LEN + value.len() + overhead];
 
     // Randomly generate the nonce, then copy the cookie value as input.
     let (nonce, in_out) = data.split_at_mut(NONCE_LEN);
+    let (in_out, tag) = in_out.split_at_mut(value.len());
+    in_out.copy_from_slice(value);
+
+    // Randomly generate the nonce into the nonce piece.
     SystemRandom::new()
         .fill(nonce)
         .expect("couldn't random fill nonce");
-    in_out[..value.len()].copy_from_slice(value);
+    let nonce = Nonce::try_assume_unique_for_key(nonce).expect("invalid `nonce` length");
-    let nonce =
-        Nonce::try_assume_unique_for_key(nonce).expect("invalid length of `nonce`");
 
     // Use cookie's name as associated data to prevent value swapping.
     let ad = Aad::from(name);
+    let ad_tag = key
+        .seal_in_place_separate_tag(nonce, ad, in_out)
+        .expect("in-place seal");
 
-    // Perform the actual sealing operation and get the output length.
+    // Copy the tag into the tag piece.
-    let output_len =
+    tag.copy_from_slice(ad_tag.as_ref());
-        seal_in_place(&key, nonce, ad, in_out, overhead).expect("in-place seal");
 
     // Remove the overhead and return the sealed content.
-    data.truncate(NONCE_LEN + output_len);
     data
 }
 

actix-http/src/cookie/secure/signed.rs

@@ -1,12 +1,11 @@
-use ring::digest::{Algorithm, SHA256};
+use ring::hmac::{self, sign, verify};
-use ring::hmac::{sign, verify_with_own_key as verify, SigningKey};
 
 use super::Key;
 use crate::cookie::{Cookie, CookieJar};
 
 // Keep these in sync, and keep the key len synced with the `signed` docs as
 // well as the `KEYS_INFO` const in secure::Key.
-static HMAC_DIGEST: &Algorithm = &SHA256;
+static HMAC_DIGEST: hmac::Algorithm = hmac::HMAC_SHA256;
 const BASE64_DIGEST_LEN: usize = 44;
 pub const KEY_LEN: usize = 32;
 
@@ -21,7 +20,7 @@ pub const KEY_LEN: usize = 32;
 /// This type is only available when the `secure` feature is enabled.
 pub struct SignedJar<'a> {
     parent: &'a mut CookieJar,
-    key: SigningKey,
+    key: hmac::Key,
 }
 
 impl<'a> SignedJar<'a> {
@@ -32,7 +31,7 @@ impl<'a> SignedJar<'a> {
     pub fn new(parent: &'a mut CookieJar, key: &Key) -> SignedJar<'a> {
         SignedJar {
             parent,
-            key: SigningKey::new(HMAC_DIGEST, key.signing()),
+            key: hmac::Key::new(HMAC_DIGEST, key.signing()),
         }
     }
 

actix-http/src/h1/payload.rs

@@ -234,7 +234,7 @@ mod tests {
     fn test_unread_data() {
         Runtime::new()
             .unwrap()
-            .block_on(lazy(|| {
+            .block_on(async {
                 let (_, mut payload) = Payload::create(false);
 
                 payload.unread_data(Bytes::from("data"));
@@ -242,13 +242,12 @@ mod tests {
                 assert_eq!(payload.len(), 4);
 
                 assert_eq!(
-                    Async::Ready(Some(Bytes::from("data"))),
+                    Poll::Ready(Some(Bytes::from("data"))),
-                    payload.poll().ok().unwrap()
+                    payload.next_item().await.ok().unwrap()
                 );
 
-                let res: Result<(), ()> = Ok(());
+                result(())
-                result(res)
+            })
-            }))
             .unwrap();
     }
 }

actix-http/tests/test_server.rs

@@ -4,10 +4,10 @@ use std::{net, thread};
 
 use actix_http_test::TestServer;
 use actix_server_config::ServerConfig;
-use actix_service::{new_service_cfg, service_fn, NewService};
+use actix_service::{factory_fn_cfg, pipeline, service_fn, ServiceFactory};
 use bytes::Bytes;
-use futures::future::{self, ok, Future};
+use futures::future::{self, err, ok, ready, Future, FutureExt};
-use futures::stream::{once, Stream};
+use futures::stream::{once, Stream, StreamExt};
 use regex::Regex;
 use tokio_timer::sleep;
 
@@ -58,9 +58,9 @@ fn test_expect_continue() {
         HttpService::build()
             .expect(service_fn(|req: Request| {
                 if req.head().uri.query() == Some("yes=") {
-                    Ok(req)
+                    ok(req)
                 } else {
-                    Err(error::ErrorPreconditionFailed("error"))
+                    err(error::ErrorPreconditionFailed("error"))
                 }
             }))
             .finish(|_| future::ok::<_, ()>(Response::Ok().finish()))
@@ -117,9 +117,12 @@ fn test_chunked_payload() {
         HttpService::build().h1(|mut request: Request| {
             request
                 .take_payload()
-                .map_err(|e| panic!(format!("Error reading payload: {}", e)))
+                .map(|res| match res {
-                .fold(0usize, |acc, chunk| future::ok::<_, ()>(acc + chunk.len()))
+                    Ok(pl) => pl,
-                .map(|req_size| Response::Ok().body(format!("size={}", req_size)))
+                    Err(e) => panic!(format!("Error reading payload: {}", e)),
+                })
+                .fold(0usize, |acc, chunk| ready(acc + chunk.len()))
+                .map(|req_size| ok(Response::Ok().body(format!("size={}", req_size))))
         })
     });
 
@@ -414,7 +417,7 @@ const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
 #[test]
 fn test_h1_body() {
     let mut srv = TestServer::new(|| {
-        HttpService::build().h1(|_| future::ok::<_, ()>(Response::Ok().body(STR)))
+        HttpService::build().h1(|_| ok::<_, ()>(Response::Ok().body(STR)))
     });
 
     let response = srv.block_on(srv.get("/").send()).unwrap();
@@ -493,7 +496,7 @@ fn test_h1_head_binary2() {
 fn test_h1_body_length() {
     let mut srv = TestServer::new(|| {
         HttpService::build().h1(|_| {
-            let body = once(Ok(Bytes::from_static(STR.as_ref())));
+            let body = once(ok(Bytes::from_static(STR.as_ref())));
             ok::<_, ()>(
                 Response::Ok().body(body::SizedStream::new(STR.len() as u64, body)),
             )
@@ -512,7 +515,7 @@ fn test_h1_body_length() {
 fn test_h1_body_chunked_explicit() {
     let mut srv = TestServer::new(|| {
         HttpService::build().h1(|_| {
-            let body = once::<_, Error>(Ok(Bytes::from_static(STR.as_ref())));
+            let body = once(ok::<_, Error>(Bytes::from_static(STR.as_ref())));
             ok::<_, ()>(
                 Response::Ok()
                     .header(header::TRANSFER_ENCODING, "chunked")
@@ -544,7 +547,7 @@ fn test_h1_body_chunked_explicit() {
 fn test_h1_body_chunked_implicit() {
     let mut srv = TestServer::new(|| {
         HttpService::build().h1(|_| {
-            let body = once::<_, Error>(Ok(Bytes::from_static(STR.as_ref())));
+            let body = once(ok::<_, Error>(Bytes::from_static(STR.as_ref())));
             ok::<_, ()>(Response::Ok().streaming(body))
         })
     });
@@ -569,15 +572,15 @@ fn test_h1_body_chunked_implicit() {
 #[test]
 fn test_h1_response_http_error_handling() {
     let mut srv = TestServer::new(|| {
-        HttpService::build().h1(new_service_cfg(|_: &ServerConfig| {
+        HttpService::build().h1(factory_fn_cfg(|_: &ServerConfig| {
-            Ok::<_, ()>(|_| {
+            ok::<_, ()>(pipeline(|_| {
                 let broken_header = Bytes::from_static(b"\0\0\0");
                 ok::<_, ()>(
                     Response::Ok()
                         .header(http::header::CONTENT_TYPE, broken_header)
                         .body(STR),
                 )
-            })
+            }))
         }))
     });
 
@@ -593,7 +596,7 @@ fn test_h1_response_http_error_handling() {
 fn test_h1_service_error() {
     let mut srv = TestServer::new(|| {
         HttpService::build()
-            .h1(|_| Err::<Response, Error>(error::ErrorBadRequest("error")))
+            .h1(|_| future::err::<Response, Error>(error::ErrorBadRequest("error")))
     });
 
     let response = srv.block_on(srv.get("/").send()).unwrap();